C15H16F3N5O — CID 135139087
N-[(3E,5E)-3-methyl-6-(trifluoromethoxy)octa-3,5,7-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 135139087) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is N-[(3E,5E)-3-methyl-6-(trifluoromethoxy)octa-3,5,7-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[(3E,5E)-3-methyl-6-(trifluoromethoxy)octa-3,5,7-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 135139087 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(3E,5E)-3-methyl-6-(trifluoromethoxy)octa-3,5,7-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=C/C(=C\C=C(/C)C(C)Nc1ccnc2ncnn12)OC(F)(F)F |
| InChI | InChI=1S/C15H16F3N5O/c1-4-12(24-15(16,17)18)6-5-10(2)11(3)22-13-7-8-19-14-20-9-21-23(13)14/h4-9,11,22H,1H2,2-3H3/b10-5+,12-6+ |
| InChIKey | VIWVBYLOXGMBIK-NPPOFJFTSA-N |
| XLogP | 3.48 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|