C48H65N2O3+ — CID 135139158
[2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]acetate (PubChem CID 135139158) has the molecular formula C48H65N2O3+ and a molecular weight of 718.06 g/mol. Its IUPAC name is [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]acetate.
| Compound Name | [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 135139158 |
| Molecular Formula | C48H65N2O3+ |
| Molecular Weight | 718.06 g/mol |
| Exact Mass | 717.50 |
| IUPAC Name | [2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinolin-1-ium-1-yl]acetate |
| SMILES | Cc1cc(OC(=O)C[n+]2c(/C=C/c3ccc(N(C)C)cc3)ccc3ccccc32)cc2c1OC(C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C48H65N2O3/c1-35(2)14-11-15-36(3)16-12-17-37(4)18-13-30-48(6)31-29-41-33-44(32-38(5)47(41)53-48)52-46(51)34-50-43(28-24-40-19-9-10-20-45(40)50)27-23-39-21-25-42(26-22-39)49(7)8/h9-10,19-28,32-33,35-37H,11-18,29-31,34H2,1-8H3/q+1 |
| InChIKey | UAEILNPBPGACLN-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.06 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|