C12H8F2N2O4S — CID 135139263
3-(difluoromethyl)-5-(2,6-dioxopiperidin-3-yl)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 135139263) has the molecular formula C12H8F2N2O4S and a molecular weight of 314.27 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-(2,6-dioxopiperidin-3-yl)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-(difluoromethyl)-5-(2,6-dioxopiperidin-3-yl)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 135139263 |
| Molecular Formula | C12H8F2N2O4S |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3-(difluoromethyl)-5-(2,6-dioxopiperidin-3-yl)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3csc(C(F)F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C12H8F2N2O4S/c13-9(14)8-7-4(3-21-8)11(19)16(12(7)20)5-1-2-6(17)15-10(5)18/h3,5,9H,1-2H2,(H,15,17,18) |
| InChIKey | MIDYYBPBHCEINA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|