About (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one
(6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one (PubChem CID 135139693) has the molecular formula C8H12O2S
and a molecular weight of 172.25 g/mol. Its IUPAC name is (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one.
Molecular Properties
| Compound Name | (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one |
| PubChem CID | 135139693 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one |
| SMILES | CC[C@@]1(O)C=CCCSC1=O |
| InChI | InChI=1S/C8H12O2S/c1-2-8(10)5-3-4-6-11-7(8)9/h3,5,10H,2,4,6H2,1H3/t8-/m1/s1 |
| InChIKey | MKKPMLVJEREGIV-MRVPVSSYSA-N |
| XLogP | 1.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one?
The IUPAC name of (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one (CID 135139693) is (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one.
What is the SMILES notation for (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one?
The canonical SMILES for (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one is CC[C@@]1(O)C=CCCSC1=O.
What is the InChIKey of (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one?
The InChIKey is MKKPMLVJEREGIV-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H12O2S/c1-2-8(10)5-3-4-6-11-7(8)9/h3,5,10H,2,4,6H2,1H3/t8-/m1/s1.
What are the key properties of (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one?
(6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one has a molecular weight of 172.25 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-ethyl-6-hydroxy-2,3-dihydrothiepin-7-one is sourced from PubChem (CID 135139693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).