About (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one
(5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one (PubChem CID 135139719) has the molecular formula C9H14O2S
and a molecular weight of 186.28 g/mol. Its IUPAC name is (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one.
Molecular Properties
| Compound Name | (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one |
| PubChem CID | 135139719 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one |
| SMILES | CC[C@]1(O)C(=O)SCC(C)=C1C |
| InChI | InChI=1S/C9H14O2S/c1-4-9(11)7(3)6(2)5-12-8(9)10/h11H,4-5H2,1-3H3/t9-/m1/s1 |
| InChIKey | KMRSDXNVCLJPAI-SECBINFHSA-N |
| XLogP | 1.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one?
The IUPAC name of (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one (CID 135139719) is (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one.
What is the SMILES notation for (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one?
The canonical SMILES for (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one is CC[C@]1(O)C(=O)SCC(C)=C1C.
What is the InChIKey of (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one?
The InChIKey is KMRSDXNVCLJPAI-SECBINFHSA-N. The full InChI is InChI=1S/C9H14O2S/c1-4-9(11)7(3)6(2)5-12-8(9)10/h11H,4-5H2,1-3H3/t9-/m1/s1.
What are the key properties of (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one?
(5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one has a molecular weight of 186.28 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-ethyl-5-hydroxy-3,4-dimethyl-2H-thiopyran-6-one is sourced from PubChem (CID 135139719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).