C27H31F2IN4O3 — CID 135140683
N-[3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]propyl]carbamoyl iodide (PubChem CID 135140683) has the molecular formula C27H31F2IN4O3 and a molecular weight of 624.47 g/mol. Its IUPAC name is N-[3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]propyl]carbamoyl iodide.
| Compound Name | N-[3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]propyl]carbamoyl iodide |
|---|---|
| PubChem CID | 135140683 |
| Molecular Formula | C27H31F2IN4O3 |
| Molecular Weight | 624.47 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | N-[3-[[(1R)-1-[1-benzyl-4-(2,5-difluorophenyl)imidazol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]propyl]carbamoyl iodide |
| SMILES | CC(C)(C)[C@H](c1nc(-c2cc(F)ccc2F)cn1Cc1ccccc1)N(CCCNC(=O)I)C(=O)CO |
| InChI | InChI=1S/C27H31F2IN4O3/c1-27(2,3)24(34(23(36)17-35)13-7-12-31-26(30)37)25-32-22(20-14-19(28)10-11-21(20)29)16-33(25)15-18-8-5-4-6-9-18/h4-6,8-11,14,16,24,35H,7,12-13,15,17H2,1-3H3,(H,31,37)/t24-/m0/s1 |
| InChIKey | YJPOVXYJHFDVQK-DEOSSOPVSA-N |
| XLogP | 5.32 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|