About 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene
4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene (PubChem CID 135140881) has the molecular formula C15H19FO2S
and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene.
Molecular Properties
| Compound Name | 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene |
| PubChem CID | 135140881 |
| Molecular Formula | C15H19FO2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene |
| SMILES | C=CC(=C)OC1CC(Oc2csc(C(C)(C)F)c2)C1 |
| InChI | InChI=1S/C15H19FO2S/c1-5-10(2)17-11-6-12(7-11)18-13-8-14(19-9-13)15(3,4)16/h5,8-9,11-12H,1-2,6-7H2,3-4H3 |
| InChIKey | FURPROHGBGRVKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene?
The IUPAC name of 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene (CID 135140881) is 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene.
What is the SMILES notation for 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene?
The canonical SMILES for 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene is C=CC(=C)OC1CC(Oc2csc(C(C)(C)F)c2)C1.
What is the InChIKey of 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene?
The InChIKey is FURPROHGBGRVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO2S/c1-5-10(2)17-11-6-12(7-11)18-13-8-14(19-9-13)15(3,4)16/h5,8-9,11-12H,1-2,6-7H2,3-4H3.
What are the key properties of 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene?
4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene has a molecular weight of 282.38 g/mol, XLogP of 4.58, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-buta-1,3-dien-2-yloxycyclobutyl)oxy-2-(2-fluoropropan-2-yl)thiophene is sourced from PubChem (CID 135140881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).