About 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one
2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one (PubChem CID 135141455) has the molecular formula C24H20O4
and a molecular weight of 372.42 g/mol. Its IUPAC name is 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one.
Molecular Properties
| Compound Name | 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one |
| PubChem CID | 135141455 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one |
| SMILES | CC(C)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Cc2cc(O)ccc21 |
| InChI | InChI=1S/C24H20O4/c1-13(2)14-3-6-22-19(12-14)23(27)28-24(22)20-7-4-17(25)10-15(20)9-16-11-18(26)5-8-21(16)24/h3-8,10-13,25-26H,9H2,1-2H3 |
| InChIKey | YDAYCXOPOXVEDU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one?
The IUPAC name of 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one (CID 135141455) is 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one.
What is the SMILES notation for 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one?
The canonical SMILES for 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one is CC(C)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Cc2cc(O)ccc21.
What is the InChIKey of 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one?
The InChIKey is YDAYCXOPOXVEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O4/c1-13(2)14-3-6-22-19(12-14)23(27)28-24(22)20-7-4-17(25)10-15(20)9-16-11-18(26)5-8-21(16)24/h3-8,10-13,25-26H,9H2,1-2H3.
What are the key properties of 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one?
2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one has a molecular weight of 372.42 g/mol, XLogP of 4.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2',7'-dihydroxy-6-propan-2-ylspiro[2-benzofuran-3,10'-9H-anthracene]-1-one is sourced from PubChem (CID 135141455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).