C35H44F3N3O2 — CID 135141466
1-[(2S,4R)-6-[3-(dipentylamino)phenyl]-2-methyl-4-[2-(trifluoromethoxy)anilino]-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 135141466) has the molecular formula C35H44F3N3O2 and a molecular weight of 595.75 g/mol. Its IUPAC name is 1-[(2S,4R)-6-[3-(dipentylamino)phenyl]-2-methyl-4-[2-(trifluoromethoxy)anilino]-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2S,4R)-6-[3-(dipentylamino)phenyl]-2-methyl-4-[2-(trifluoromethoxy)anilino]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 135141466 |
| Molecular Formula | C35H44F3N3O2 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | 1-[(2S,4R)-6-[3-(dipentylamino)phenyl]-2-methyl-4-[2-(trifluoromethoxy)anilino]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CCCCCN(CCCCC)c1cccc(-c2ccc3c(c2)[C@H](Nc2ccccc2OC(F)(F)F)C[C@H](C)N3C(C)=O)c1 |
| InChI | InChI=1S/C35H44F3N3O2/c1-5-7-11-20-40(21-12-8-6-2)29-15-13-14-27(23-29)28-18-19-33-30(24-28)32(22-25(3)41(33)26(4)42)39-31-16-9-10-17-34(31)43-35(36,37)38/h9-10,13-19,23-25,32,39H,5-8,11-12,20-22H2,1-4H3/t25-,32+/m0/s1 |
| InChIKey | BDVCRNVVNIKGGU-ZOYWYXQUSA-N |
| XLogP | 9.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|