About 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde
6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde (PubChem CID 135141595) has the molecular formula C24H24N2O2
and a molecular weight of 372.47 g/mol. Its IUPAC name is 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde.
Molecular Properties
| Compound Name | 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde |
| PubChem CID | 135141595 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde |
| SMILES | Cc1c(-c2ccc3c(c2)CCC2(CCN(C=O)CC2)O3)ccc2cccnc12 |
| InChI | InChI=1S/C24H24N2O2/c1-17-21(6-4-18-3-2-12-25-23(17)18)19-5-7-22-20(15-19)8-9-24(28-22)10-13-26(16-27)14-11-24/h2-7,12,15-16H,8-11,13-14H2,1H3 |
| InChIKey | NSWYBAVGERUILG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde?
The IUPAC name of 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde (CID 135141595) is 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde.
What is the SMILES notation for 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde?
The canonical SMILES for 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde is Cc1c(-c2ccc3c(c2)CCC2(CCN(C=O)CC2)O3)ccc2cccnc12.
What is the InChIKey of 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde?
The InChIKey is NSWYBAVGERUILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O2/c1-17-21(6-4-18-3-2-12-25-23(17)18)19-5-7-22-20(15-19)8-9-24(28-22)10-13-26(16-27)14-11-24/h2-7,12,15-16H,8-11,13-14H2,1H3.
What are the key properties of 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde?
6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde has a molecular weight of 372.47 g/mol, XLogP of 4.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(8-methylquinolin-7-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carbaldehyde is sourced from PubChem (CID 135141595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).