About 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole
5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole (PubChem CID 135141870) has the molecular formula C10H15F3N2
and a molecular weight of 220.24 g/mol. Its IUPAC name is 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole |
| PubChem CID | 135141870 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole |
| SMILES | CC(CCC(C)C(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C10H15F3N2/c1-7(9-5-6-14-15-9)3-4-8(2)10(11,12)13/h5-8H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | UYTJAKHGXYCBQU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole?
The IUPAC name of 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole (CID 135141870) is 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole.
What is the SMILES notation for 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole?
The canonical SMILES for 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole is CC(CCC(C)C(F)(F)F)c1ccn[nH]1.
What is the InChIKey of 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole?
The InChIKey is UYTJAKHGXYCBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2/c1-7(9-5-6-14-15-9)3-4-8(2)10(11,12)13/h5-8H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole?
5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole has a molecular weight of 220.24 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6,6,6-trifluoro-5-methylhexan-2-yl)-1H-pyrazole is sourced from PubChem (CID 135141870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).