C28H33N7O2 — CID 135141890
N-[3-[1-acetyl-4-[4-[(Z)-N-amino-N-methylcarbamohydrazonoyl]anilino]-2-methyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]acetamide (PubChem CID 135141890) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[3-[1-acetyl-4-[4-[(Z)-N-amino-N-methylcarbamohydrazonoyl]anilino]-2-methyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]acetamide.
| Compound Name | N-[3-[1-acetyl-4-[4-[(Z)-N-amino-N-methylcarbamohydrazonoyl]anilino]-2-methyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 135141890 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | N-[3-[1-acetyl-4-[4-[(Z)-N-amino-N-methylcarbamohydrazonoyl]anilino]-2-methyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2ccc3c(c2)C(Nc2ccc(/C(=N/N)N(C)N)cc2)CC(C)N3C(C)=O)c1 |
| InChI | InChI=1S/C28H33N7O2/c1-17-14-26(32-23-11-8-20(9-12-23)28(33-29)34(4)30)25-16-22(10-13-27(25)35(17)19(3)37)21-6-5-7-24(15-21)31-18(2)36/h5-13,15-17,26,32H,14,29-30H2,1-4H3,(H,31,36)/b33-28- |
| InChIKey | NUAZLNZTJINUGX-MDVFONAFSA-N |
| XLogP | 4.04 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|