About 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one
4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one (PubChem CID 135142040) has the molecular formula C19H34O
and a molecular weight of 278.48 g/mol. Its IUPAC name is 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one.
Molecular Properties
| Compound Name | 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one |
| PubChem CID | 135142040 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one |
| SMILES | CC(C)C1CC(CC(C)(C)C2CCC(C)(C)C2)CC1=O |
| InChI | InChI=1S/C19H34O/c1-13(2)16-9-14(10-17(16)20)11-19(5,6)15-7-8-18(3,4)12-15/h13-16H,7-12H2,1-6H3 |
| InChIKey | XJPKVCRMOHBJLP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one?
The IUPAC name of 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one (CID 135142040) is 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one.
What is the SMILES notation for 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one?
The canonical SMILES for 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one is CC(C)C1CC(CC(C)(C)C2CCC(C)(C)C2)CC1=O.
What is the InChIKey of 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one?
The InChIKey is XJPKVCRMOHBJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O/c1-13(2)16-9-14(10-17(16)20)11-19(5,6)15-7-8-18(3,4)12-15/h13-16H,7-12H2,1-6H3.
What are the key properties of 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one?
4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one has a molecular weight of 278.48 g/mol, XLogP of 5.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-dimethylcyclopentyl)-2-methylpropyl]-2-propan-2-ylcyclopentan-1-one is sourced from PubChem (CID 135142040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).