C31H38F3N5O2 — CID 135142112
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-methyl-3-[4-methyl-3-[[7-(trifluoromethyl)-1,3,4,5-tetrahydro-1,2-benzodiazepin-2-yl]methyl]phenyl]propanoic acid (PubChem CID 135142112) has the molecular formula C31H38F3N5O2 and a molecular weight of 569.67 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-methyl-3-[4-methyl-3-[[7-(trifluoromethyl)-1,3,4,5-tetrahydro-1,2-benzodiazepin-2-yl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-methyl-3-[4-methyl-3-[[7-(trifluoromethyl)-1,3,4,5-tetrahydro-1,2-benzodiazepin-2-yl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135142112 |
| Molecular Formula | C31H38F3N5O2 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2-methyl-3-[4-methyl-3-[[7-(trifluoromethyl)-1,3,4,5-tetrahydro-1,2-benzodiazepin-2-yl]methyl]phenyl]propanoic acid |
| SMILES | CCN(N)c1ccc(C(c2ccc(C)c(CN3CCCc4cc(C(F)(F)F)ccc4N3)c2)C(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C31H38F3N5O2/c1-5-39(36)27-13-11-25(19(3)29(27)35)28(20(4)30(40)41)22-9-8-18(2)23(15-22)17-38-14-6-7-21-16-24(31(32,33)34)10-12-26(21)37-38/h8-13,15-16,20,28,37H,5-7,14,17,35-36H2,1-4H3,(H,40,41) |
| InChIKey | AYDFJHCXLCCIAD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|