C26H29FN2O3 — CID 135142207
benzyl 3-[3-amino-4-(ethylamino)-2-fluorophenyl]-3-[3-(hydroxymethyl)-4-methylphenyl]propanoate (PubChem CID 135142207) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is benzyl 3-[3-amino-4-(ethylamino)-2-fluorophenyl]-3-[3-(hydroxymethyl)-4-methylphenyl]propanoate.
| Compound Name | benzyl 3-[3-amino-4-(ethylamino)-2-fluorophenyl]-3-[3-(hydroxymethyl)-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 135142207 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | benzyl 3-[3-amino-4-(ethylamino)-2-fluorophenyl]-3-[3-(hydroxymethyl)-4-methylphenyl]propanoate |
| SMILES | CCNc1ccc(C(CC(=O)OCc2ccccc2)c2ccc(C)c(CO)c2)c(F)c1N |
| InChI | InChI=1S/C26H29FN2O3/c1-3-29-23-12-11-21(25(27)26(23)28)22(19-10-9-17(2)20(13-19)15-30)14-24(31)32-16-18-7-5-4-6-8-18/h4-13,22,29-30H,3,14-16,28H2,1-2H3 |
| InChIKey | MSBUHCNANJTNLM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|