C30H37FN4O3S — CID 135142254
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[(4S)-8-fluoro-4-methyl-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]propanoic acid (PubChem CID 135142254) has the molecular formula C30H37FN4O3S and a molecular weight of 552.72 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[(4S)-8-fluoro-4-methyl-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[(4S)-8-fluoro-4-methyl-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 135142254 |
| Molecular Formula | C30H37FN4O3S |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-[3-[[(4S)-8-fluoro-4-methyl-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl]methyl]-4-methylphenyl]propanoic acid |
| SMILES | CCN(N)c1ccc(C(CC(=O)O)c2ccc(C)c(CN3C[C@@H](C)Cc4ccc(F)cc4S3=O)c2)c(C)c1N |
| InChI | InChI=1S/C30H37FN4O3S/c1-5-35(33)27-11-10-25(20(4)30(27)32)26(15-29(36)37)21-7-6-19(3)23(13-21)17-34-16-18(2)12-22-8-9-24(31)14-28(22)39(34)38/h6-11,13-14,18,26H,5,12,15-17,32-33H2,1-4H3,(H,36,37)/t18-,26?,39?/m0/s1 |
| InChIKey | PDAAGFVLMCBMPD-ORHZKBDLSA-N |
| XLogP | 5.05 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|