C27H33N7O2 — CID 135142423
4-[[2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetyl]amino]bicyclo[2.2.2]octane-1-carboxamide (PubChem CID 135142423) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 4-[[2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetyl]amino]bicyclo[2.2.2]octane-1-carboxamide.
| Compound Name | 4-[[2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetyl]amino]bicyclo[2.2.2]octane-1-carboxamide |
|---|---|
| PubChem CID | 135142423 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 4-[[2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetyl]amino]bicyclo[2.2.2]octane-1-carboxamide |
| SMILES | N#CCC1CCC(n2c(CC(=O)NC34CCC(C(N)=O)(CC3)CC4)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C27H33N7O2/c28-13-5-17-1-3-18(4-2-17)34-21(32-20-16-31-24-19(23(20)34)6-14-30-24)15-22(35)33-27-10-7-26(8-11-27,9-12-27)25(29)36/h6,14,16-18H,1-5,7-12,15H2,(H2,29,36)(H,30,31)(H,33,35) |
| InChIKey | VGQGFYCOZCNACG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |