C21H26N6O2 — CID 135142456
3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxy-2-methylpropyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide (PubChem CID 135142456) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxy-2-methylpropyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide.
| Compound Name | 3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxy-2-methylpropyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 135142456 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxy-2-methylpropyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
| SMILES | CC(C)(O)CNC(=O)c1nc2cnc3[nH]ccc3c2n1C1CCC(CC#N)CC1 |
| InChI | InChI=1S/C21H26N6O2/c1-21(2,29)12-25-20(28)19-26-16-11-24-18-15(8-10-23-18)17(16)27(19)14-5-3-13(4-6-14)7-9-22/h8,10-11,13-14,29H,3-7,12H2,1-2H3,(H,23,24)(H,25,28) |
| InChIKey | JDOSSKSQTWYHPE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |