C22H26N6O — CID 135142627
2-[4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 135142627) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 135142627 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | N#CCC1CCC(n2c(CC(=O)N3CCCC3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C22H26N6O/c23-9-7-15-3-5-16(6-4-15)28-19(13-20(29)27-11-1-2-12-27)26-18-14-25-22-17(21(18)28)8-10-24-22/h8,10,14-16H,1-7,11-13H2,(H,24,25) |
| InChIKey | VEPPHPJVFXUYOF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |