C24H24N6O2 — CID 135142706
phenyl N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate (PubChem CID 135142706) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is phenyl N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate.
| Compound Name | phenyl N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 135142706 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | phenyl N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate |
| SMILES | N#CCC1CCC(n2c(CNC(=O)Oc3ccccc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C24H24N6O2/c25-12-10-16-6-8-17(9-7-16)30-21(15-28-24(31)32-18-4-2-1-3-5-18)29-20-14-27-23-19(22(20)30)11-13-26-23/h1-5,11,13-14,16-17H,6-10,15H2,(H,26,27)(H,28,31) |
| InChIKey | LWUSEYAEKRGZCX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |