C23H29N7O — CID 135142727
3-[4-(cyanomethyl)cyclohexyl]-N-(1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide (PubChem CID 135142727) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[4-(cyanomethyl)cyclohexyl]-N-(1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide.
| Compound Name | 3-[4-(cyanomethyl)cyclohexyl]-N-(1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 135142727 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-[4-(cyanomethyl)cyclohexyl]-N-(1-methylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
| SMILES | CN1CCC(NC(=O)c2nc3cnc4[nH]ccc4c3n2C2CCC(CC#N)CC2)CC1 |
| InChI | InChI=1S/C23H29N7O/c1-29-12-8-16(9-13-29)27-23(31)22-28-19-14-26-21-18(7-11-25-21)20(19)30(22)17-4-2-15(3-5-17)6-10-24/h7,11,14-17H,2-6,8-9,12-13H2,1H3,(H,25,26)(H,27,31) |
| InChIKey | GGOMFXZUBQJRPC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |