C24H23N7O2S — CID 135142732
4-cyano-N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide (PubChem CID 135142732) has the molecular formula C24H23N7O2S and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-cyano-N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135142732 |
| Molecular Formula | C24H23N7O2S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-cyano-N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide |
| SMILES | N#CCC1CCC(n2c(CNS(=O)(=O)c3ccc(C#N)cc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C24H23N7O2S/c25-11-9-16-1-5-18(6-2-16)31-22(30-21-14-28-24-20(23(21)31)10-12-27-24)15-29-34(32,33)19-7-3-17(13-26)4-8-19/h3-4,7-8,10,12,14,16,18,29H,1-2,5-6,9,15H2,(H,27,28) |
| InChIKey | BFWTVBLDMYXCPC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |