C19H22N6O2 — CID 135142861
3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide (PubChem CID 135142861) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide.
| Compound Name | 3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 135142861 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-[4-(cyanomethyl)cyclohexyl]-N-(2-hydroxyethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
| SMILES | N#CCC1CCC(n2c(C(=O)NCCO)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C19H22N6O2/c20-7-5-12-1-3-13(4-2-12)25-16-14-6-8-21-17(14)23-11-15(16)24-18(25)19(27)22-9-10-26/h6,8,11-13,26H,1-5,9-10H2,(H,21,23)(H,22,27) |
| InChIKey | XTIHZVSIRQCNKD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |