C23H24N6O2S — CID 135142880
N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide (PubChem CID 135142880) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135142880 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]benzenesulfonamide |
| SMILES | N#CCC1CCC(n2c(CNS(=O)(=O)c3ccccc3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C23H24N6O2S/c24-12-10-16-6-8-17(9-7-16)29-21(15-27-32(30,31)18-4-2-1-3-5-18)28-20-14-26-23-19(22(20)29)11-13-25-23/h1-5,11,13-14,16-17,27H,6-10,15H2,(H,25,26) |
| InChIKey | KNONSVMAKLLANO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |