C23H25N7O2 — CID 135143116
ethyl 2-[4-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]pyrazol-1-yl]acetate (PubChem CID 135143116) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 135143116 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 2-[4-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(-c2nc3cnc4[nH]ccc4c3n2C2CCC(CC#N)CC2)cn1 |
| InChI | InChI=1S/C23H25N7O2/c1-2-32-20(31)14-29-13-16(11-27-29)23-28-19-12-26-22-18(8-10-25-22)21(19)30(23)17-5-3-15(4-6-17)7-9-24/h8,10-13,15,17H,2-7,14H2,1H3,(H,25,26) |
| InChIKey | LJFNJWRTVJKKJZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |