C12H11FN2O3 — CID 135143261
(7aS)-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione (PubChem CID 135143261) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is (7aS)-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione.
| Compound Name | (7aS)-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 135143261 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (7aS)-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione |
| SMILES | CN1C(=O)N2COC[C@@]2(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C12H11FN2O3/c1-14-10(16)12(6-18-7-15(12)11(14)17)8-3-2-4-9(13)5-8/h2-5H,6-7H2,1H3/t12-/m1/s1 |
| InChIKey | HFXUYQMTEOMHGW-GFCCVEGCSA-N |
| XLogP | 0.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|