C16H16BrN — CID 135143831
6-bromo-2-[(5Z)-3-ethenylocta-1,3,5,7-tetraen-4-yl]-3-methylpyridine (PubChem CID 135143831) has the molecular formula C16H16BrN and a molecular weight of 302.22 g/mol. Its IUPAC name is 6-bromo-2-[(5Z)-3-ethenylocta-1,3,5,7-tetraen-4-yl]-3-methylpyridine.
| Compound Name | 6-bromo-2-[(5Z)-3-ethenylocta-1,3,5,7-tetraen-4-yl]-3-methylpyridine |
|---|---|
| PubChem CID | 135143831 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 6-bromo-2-[(5Z)-3-ethenylocta-1,3,5,7-tetraen-4-yl]-3-methylpyridine |
| SMILES | C=C/C=C\C(=C(C=C)C=C)c1nc(Br)ccc1C |
| InChI | InChI=1S/C16H16BrN/c1-5-8-9-14(13(6-2)7-3)16-12(4)10-11-15(17)18-16/h5-11H,1-3H2,4H3/b9-8- |
| InChIKey | PYPIUWZTZRROHE-HJWRWDBZSA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|