C15H11F5O4S2 — CID 135144251
5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(2,2,3,3,3-pentafluoropropyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 135144251) has the molecular formula C15H11F5O4S2 and a molecular weight of 414.37 g/mol. Its IUPAC name is 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(2,2,3,3,3-pentafluoropropyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(2,2,3,3,3-pentafluoropropyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 135144251 |
| Molecular Formula | C15H11F5O4S2 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-7-(2,2,3,3,3-pentafluoropropyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | FC(F)(F)C(F)(F)Cc1sc(-c2scc3c2OCCO3)c2c1OCCO2 |
| InChI | InChI=1S/C15H11F5O4S2/c16-14(17,15(18,19)20)5-8-10-11(24-4-3-23-10)13(26-8)12-9-7(6-25-12)21-1-2-22-9/h6H,1-5H2 |
| InChIKey | ZQDUTJPILZYVGH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|