C17H16ClFN2 — CID 135144505
2-[(4-chloro-N-propylanilino)methyl]-4-fluorobenzonitrile (PubChem CID 135144505) has the molecular formula C17H16ClFN2 and a molecular weight of 302.78 g/mol. Its IUPAC name is 2-[(4-chloro-N-propylanilino)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(4-chloro-N-propylanilino)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 135144505 |
| Molecular Formula | C17H16ClFN2 |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-[(4-chloro-N-propylanilino)methyl]-4-fluorobenzonitrile |
| SMILES | CCCN(Cc1cc(F)ccc1C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClFN2/c1-2-9-21(17-7-4-15(18)5-8-17)12-14-10-16(19)6-3-13(14)11-20/h3-8,10H,2,9,12H2,1H3 |
| InChIKey | NRYSDFGXUHADFK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |