C16H28N6O2 — CID 135144922
tert-butyl 4-[2-(2-methyltetrazol-5-yl)pyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 135144922) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-methyltetrazol-5-yl)pyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-methyltetrazol-5-yl)pyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135144922 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | tert-butyl 4-[2-(2-methyltetrazol-5-yl)pyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | Cn1nnc(C2CCCN2C2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C16H28N6O2/c1-16(2,3)24-15(23)21-10-7-12(8-11-21)22-9-5-6-13(22)14-17-19-20(4)18-14/h12-13H,5-11H2,1-4H3 |
| InChIKey | OJHJFYHDVUMZPT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |