About US10941138, Example 47
US10941138, Example 47 (PubChem CID 135145256) has the molecular formula C17H17FN2OS
and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-(3-fluorothiophen-2-yl)-3-isoquinolin-8-yloxy-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | US10941138, Example 47 |
| PubChem CID | 135145256 |
| Molecular Formula | C17H17FN2OS |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-(3-fluorothiophen-2-yl)-3-isoquinolin-8-yloxy-N-methylpropan-1-amine |
| SMILES | CNCCC(C1=C(C=CS1)F)OC2=CC=CC3=C2C=NC=C3 |
| InChI | InChI=1S/C17H17FN2OS/c1-19-8-6-16(17-14(18)7-10-22-17)21-15-4-2-3-12-5-9-20-11-13(12)15/h2-5,7,9-11,16,19H,6,8H2,1H3 |
| InChIKey | KNCJEJULKKTIEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 347 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze US10941138, Example 47 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10941138, Example 47?
The IUPAC name of US10941138, Example 47 (CID 135145256) is 3-(3-fluorothiophen-2-yl)-3-isoquinolin-8-yloxy-N-methylpropan-1-amine.
What is the SMILES notation for US10941138, Example 47?
The canonical SMILES for US10941138, Example 47 is CNCCC(C1=C(C=CS1)F)OC2=CC=CC3=C2C=NC=C3.
What is the InChIKey of US10941138, Example 47?
The InChIKey is KNCJEJULKKTIEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2OS/c1-19-8-6-16(17-14(18)7-10-22-17)21-15-4-2-3-12-5-9-20-11-13(12)15/h2-5,7,9-11,16,19H,6,8H2,1H3.
What are the key properties of US10941138, Example 47?
US10941138, Example 47 has a molecular weight of 316.40 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for US10941138, Example 47 is sourced from PubChem (CID 135145256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).