C25H21FN6O — CID 135145577
N-(3-aminopropyl)-3-(8-fluoro-4-pyridin-3-ylquinolin-6-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 135145577) has the molecular formula C25H21FN6O and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(8-fluoro-4-pyridin-3-ylquinolin-6-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-(3-aminopropyl)-3-(8-fluoro-4-pyridin-3-ylquinolin-6-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 135145577 |
| Molecular Formula | C25H21FN6O |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-(3-aminopropyl)-3-(8-fluoro-4-pyridin-3-ylquinolin-6-yl)-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | NCCCNC(=O)c1cnc2[nH]cc(-c3cc(F)c4nccc(-c5cccnc5)c4c3)c2c1 |
| InChI | InChI=1S/C25H21FN6O/c26-22-11-16(9-19-18(4-8-29-23(19)22)15-3-1-6-28-12-15)21-14-32-24-20(21)10-17(13-31-24)25(33)30-7-2-5-27/h1,3-4,6,8-14H,2,5,7,27H2,(H,30,33)(H,31,32) |
| InChIKey | KKFPJHVUJKQCPA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|