About 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride
8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride (PubChem CID 135146028) has the molecular formula C16H11Cl2N3
and a molecular weight of 316.19 g/mol. Its IUPAC name is 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride.
Molecular Properties
| Compound Name | 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride |
| PubChem CID | 135146028 |
| Molecular Formula | C16H11Cl2N3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride |
| SMILES | Cl.Clc1cc(-c2c[nH]c3ncccc23)cc2cccnc12 |
| InChI | InChI=1S/C16H10ClN3.ClH/c17-14-8-11(7-10-3-1-5-18-15(10)14)13-9-20-16-12(13)4-2-6-19-16;/h1-9H,(H,19,20);1H |
| InChIKey | NPBUNTQKBSLGMM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride?
The IUPAC name of 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride (CID 135146028) is 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride.
What is the SMILES notation for 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride?
The canonical SMILES for 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride is Cl.Clc1cc(-c2c[nH]c3ncccc23)cc2cccnc12.
What is the InChIKey of 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride?
The InChIKey is NPBUNTQKBSLGMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3.ClH/c17-14-8-11(7-10-3-1-5-18-15(10)14)13-9-20-16-12(13)4-2-6-19-16;/h1-9H,(H,19,20);1H.
What are the key properties of 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride?
8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride has a molecular weight of 316.19 g/mol, XLogP of 4.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinoline;hydrochloride is sourced from PubChem (CID 135146028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).