C33H33ClN6O4 — CID 135146181
N-[2-chloro-3-[3-[[3-[(2-hydroxyethylamino)methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]phenyl]-5-(dimethoxymethyl)pyridine-2-carboxamide (PubChem CID 135146181) has the molecular formula C33H33ClN6O4 and a molecular weight of 613.12 g/mol. Its IUPAC name is N-[2-chloro-3-[3-[[3-[(2-hydroxyethylamino)methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]phenyl]-5-(dimethoxymethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-chloro-3-[3-[[3-[(2-hydroxyethylamino)methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]phenyl]-5-(dimethoxymethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135146181 |
| Molecular Formula | C33H33ClN6O4 |
| Molecular Weight | 613.12 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | N-[2-chloro-3-[3-[[3-[(2-hydroxyethylamino)methyl]-1,7-naphthyridin-8-yl]amino]-2-methylphenyl]phenyl]-5-(dimethoxymethyl)pyridine-2-carboxamide |
| SMILES | COC(OC)c1ccc(C(=O)Nc2cccc(-c3cccc(Nc4nccc5cc(CNCCO)cnc45)c3C)c2Cl)nc1 |
| InChI | InChI=1S/C33H33ClN6O4/c1-20-24(6-4-8-26(20)39-31-30-22(12-13-36-31)16-21(18-38-30)17-35-14-15-41)25-7-5-9-27(29(25)34)40-32(42)28-11-10-23(19-37-28)33(43-2)44-3/h4-13,16,18-19,33,35,41H,14-15,17H2,1-3H3,(H,36,39)(H,40,42) |
| InChIKey | VPXSHSVIVDRUMA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.12 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|