2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid

C7H12F3NO3 — CID 135150266

IUPAC2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid
SMILESCC(C)(C)C(N)=O.O=C(O)C(F)(F)F
InChIInChI=1S/C5H11NO.C2HF3O2/c1-5(2,3)4(6)7;3-2(4,5)1(6)7/h1-3H3,(H2,6,7);(H,6,7)
InChIKeyAKHVDURSKKCQQR-UHFFFAOYSA-N
MW215.17 g/mol
LogP1.15
Rot. Bonds

About 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid

2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 135150266) has the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. Its IUPAC name is 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid
PubChem CID135150266
Molecular FormulaC7H12F3NO3
Molecular Weight215.17 g/mol
Exact Mass215.08
IUPAC Name2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid
SMILESCC(C)(C)C(N)=O.O=C(O)C(F)(F)F
InChIInChI=1S/C5H11NO.C2HF3O2/c1-5(2,3)4(6)7;3-2(4,5)1(6)7/h1-3H3,(H2,6,7);(H,6,7)
InChIKeyAKHVDURSKKCQQR-UHFFFAOYSA-N
XLogP1.15
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.17
LogP ≤ 51.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid?
The IUPAC name of 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid (CID 135150266) is 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid is CC(C)(C)C(N)=O.O=C(O)C(F)(F)F.
What is the InChIKey of 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid?
The InChIKey is AKHVDURSKKCQQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2HF3O2/c1-5(2,3)4(6)7;3-2(4,5)1(6)7/h1-3H3,(H2,6,7);(H,6,7).
What are the key properties of 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid?
2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid has a molecular weight of 215.17 g/mol, XLogP of 1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 135150266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).