C17H17ClFN5O3S — CID 135150583
[(1R,2S,6R,7S)-10-(3-chloro-2-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone (PubChem CID 135150583) has the molecular formula C17H17ClFN5O3S and a molecular weight of 425.87 g/mol. Its IUPAC name is [(1R,2S,6R,7S)-10-(3-chloro-2-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [(1R,2S,6R,7S)-10-(3-chloro-2-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 135150583 |
| Molecular Formula | C17H17ClFN5O3S |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | [(1R,2S,6R,7S)-10-(3-chloro-2-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1C[C@@H]2[C@H](C1)[C@@H]1CC[C@H]2N1S(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C17H17ClFN5O3S/c18-11-2-1-3-15(16(11)19)28(26,27)24-13-4-5-14(24)10-8-23(7-9(10)13)17(25)12-6-20-22-21-12/h1-3,6,9-10,13-14H,4-5,7-8H2,(H,20,21,22)/t9-,10+,13-,14+ |
| InChIKey | XUFPYVUQPPBAAW-IOQCUFBNSA-N |
| XLogP | 1.52 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |