C9H15N5O — CID 135150833
[(2S,5R)-2,5-dimethylpiperazin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 135150833) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is [(2S,5R)-2,5-dimethylpiperazin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [(2S,5R)-2,5-dimethylpiperazin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 135150833 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | [(2S,5R)-2,5-dimethylpiperazin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cn[nH]n2)[C@@H](C)CN1 |
| InChI | InChI=1S/C9H15N5O/c1-6-5-14(7(2)3-10-6)9(15)8-4-11-13-12-8/h4,6-7,10H,3,5H2,1-2H3,(H,11,12,13)/t6-,7+/m1/s1 |
| InChIKey | WMXJOTLSMIUGHB-RQJHMYQMSA-N |
| XLogP | -0.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |