C18H18N6 — CID 135150949
3-N-(2-pyridin-4-yl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl)benzene-1,3-diamine (PubChem CID 135150949) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-N-(2-pyridin-4-yl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl)benzene-1,3-diamine.
| Compound Name | 3-N-(2-pyridin-4-yl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 135150949 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 3-N-(2-pyridin-4-yl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nc(-c3ccncc3)nc3c2CNCC3)c1 |
| InChI | InChI=1S/C18H18N6/c19-13-2-1-3-14(10-13)22-18-15-11-21-9-6-16(15)23-17(24-18)12-4-7-20-8-5-12/h1-5,7-8,10,21H,6,9,11,19H2,(H,22,23,24) |
| InChIKey | QWMRIMQHLPFUIE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|