About (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid
(3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid (PubChem CID 135151777) has the molecular formula C19H27F2N3O4
and a molecular weight of 399.44 g/mol. Its IUPAC name is (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid.
Molecular Properties
| Compound Name | (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid |
| PubChem CID | 135151777 |
| Molecular Formula | C19H27F2N3O4 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid |
| SMILES | CC(C)CN(c1ncc([C@H](C)CC(=O)O)cc1[N+](=O)[O-])C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H27F2N3O4/c1-12(2)11-23(15-4-6-19(20,21)7-5-15)18-16(24(27)28)9-14(10-22-18)13(3)8-17(25)26/h9-10,12-13,15H,4-8,11H2,1-3H3,(H,25,26)/t13-/m1/s1 |
| InChIKey | PSQHZCZRBFHCOL-CYBMUJFWSA-N |
| XLogP | 4.61 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid?
The IUPAC name of (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid (CID 135151777) is (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid.
What is the SMILES notation for (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid?
The canonical SMILES for (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid is CC(C)CN(c1ncc([C@H](C)CC(=O)O)cc1[N+](=O)[O-])C1CCC(F)(F)CC1.
What is the InChIKey of (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid?
The InChIKey is PSQHZCZRBFHCOL-CYBMUJFWSA-N. The full InChI is InChI=1S/C19H27F2N3O4/c1-12(2)11-23(15-4-6-19(20,21)7-5-15)18-16(24(27)28)9-14(10-22-18)13(3)8-17(25)26/h9-10,12-13,15H,4-8,11H2,1-3H3,(H,25,26)/t13-/m1/s1.
What are the key properties of (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid?
(3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid has a molecular weight of 399.44 g/mol, XLogP of 4.61, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[6-[(4,4-difluorocyclohexyl)-(2-methylpropyl)amino]-5-nitro-3-pyridinyl]butanoic acid is sourced from PubChem (CID 135151777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).