C24H28N2O6 — CID 135152214
ethyl 2-[4-[[6-(1,3-dihydroisoindol-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]piperidin-1-yl]-2-oxoacetate (PubChem CID 135152214) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is ethyl 2-[4-[[6-(1,3-dihydroisoindol-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]piperidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[[6-(1,3-dihydroisoindol-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]piperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 135152214 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | ethyl 2-[4-[[6-(1,3-dihydroisoindol-2-ylmethyl)-4-oxopyran-3-yl]oxymethyl]piperidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCC(COc2coc(CN3Cc4ccccc4C3)cc2=O)CC1 |
| InChI | InChI=1S/C24H28N2O6/c1-2-30-24(29)23(28)26-9-7-17(8-10-26)15-32-22-16-31-20(11-21(22)27)14-25-12-18-5-3-4-6-19(18)13-25/h3-6,11,16-17H,2,7-10,12-15H2,1H3 |
| InChIKey | UALUDLVNCNMAMX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|