C21H18N2O3 — CID 135152238
5-[(3-aminophenyl)methoxy]-2-(isoindol-2-ylmethyl)pyran-4-one (PubChem CID 135152238) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-[(3-aminophenyl)methoxy]-2-(isoindol-2-ylmethyl)pyran-4-one.
| Compound Name | 5-[(3-aminophenyl)methoxy]-2-(isoindol-2-ylmethyl)pyran-4-one |
|---|---|
| PubChem CID | 135152238 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5-[(3-aminophenyl)methoxy]-2-(isoindol-2-ylmethyl)pyran-4-one |
| SMILES | Nc1cccc(COc2coc(Cn3cc4ccccc4c3)cc2=O)c1 |
| InChI | InChI=1S/C21H18N2O3/c22-18-7-3-4-15(8-18)13-26-21-14-25-19(9-20(21)24)12-23-10-16-5-1-2-6-17(16)11-23/h1-11,14H,12-13,22H2 |
| InChIKey | GVHSTBUXOGVKDT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|