C18H16FN3S — CID 135152658
7-cinnolin-3-yl-4-fluoro-4,5,5-trimethylthieno[2,3-c]pyridine (PubChem CID 135152658) has the molecular formula C18H16FN3S and a molecular weight of 325.41 g/mol. Its IUPAC name is 7-cinnolin-3-yl-4-fluoro-4,5,5-trimethylthieno[2,3-c]pyridine.
| Compound Name | 7-cinnolin-3-yl-4-fluoro-4,5,5-trimethylthieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 135152658 |
| Molecular Formula | C18H16FN3S |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 7-cinnolin-3-yl-4-fluoro-4,5,5-trimethylthieno[2,3-c]pyridine |
| SMILES | CC1(C)N=C(c2cc3ccccc3nn2)c2sccc2C1(C)F |
| InChI | InChI=1S/C18H16FN3S/c1-17(2)18(3,19)12-8-9-23-16(12)15(20-17)14-10-11-6-4-5-7-13(11)21-22-14/h4-10H,1-3H3 |
| InChIKey | PZRQMRYPUOXKEL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |