About 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline
4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline (PubChem CID 135152725) has the molecular formula C21H18F2N2O2S
and a molecular weight of 400.45 g/mol. Its IUPAC name is 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline.
Molecular Properties
| Compound Name | 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline |
| PubChem CID | 135152725 |
| Molecular Formula | C21H18F2N2O2S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline |
| SMILES | CC1(C)N=C(c2ccc3nccc(S(C)(=O)=O)c3c2)c2ccccc2C1(F)F |
| InChI | InChI=1S/C21H18F2N2O2S/c1-20(2)21(22,23)16-7-5-4-6-14(16)19(25-20)13-8-9-17-15(12-13)18(10-11-24-17)28(3,26)27/h4-12H,1-3H3 |
| InChIKey | BRURSRGXPOISSF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline?
The IUPAC name of 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline (CID 135152725) is 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline.
What is the SMILES notation for 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline?
The canonical SMILES for 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline is CC1(C)N=C(c2ccc3nccc(S(C)(=O)=O)c3c2)c2ccccc2C1(F)F.
What is the InChIKey of 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline?
The InChIKey is BRURSRGXPOISSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N2O2S/c1-20(2)21(22,23)16-7-5-4-6-14(16)19(25-20)13-8-9-17-15(12-13)18(10-11-24-17)28(3,26)27/h4-12H,1-3H3.
What are the key properties of 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline?
4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline has a molecular weight of 400.45 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3,3-dimethyl-1-(4-methylsulfonylquinolin-6-yl)isoquinoline is sourced from PubChem (CID 135152725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).