C22H21NO3 — CID 135153075
8-hydroxy-6-(3,3,4,4-tetramethylisoquinolin-1-yl)chromen-4-one (PubChem CID 135153075) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 8-hydroxy-6-(3,3,4,4-tetramethylisoquinolin-1-yl)chromen-4-one.
| Compound Name | 8-hydroxy-6-(3,3,4,4-tetramethylisoquinolin-1-yl)chromen-4-one |
|---|---|
| PubChem CID | 135153075 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 8-hydroxy-6-(3,3,4,4-tetramethylisoquinolin-1-yl)chromen-4-one |
| SMILES | CC1(C)N=C(c2cc(O)c3occc(=O)c3c2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H21NO3/c1-21(2)16-8-6-5-7-14(16)19(23-22(21,3)4)13-11-15-17(24)9-10-26-20(15)18(25)12-13/h5-12,25H,1-4H3 |
| InChIKey | PJSARUQPKABVJI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |