About 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine
3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine (PubChem CID 135153190) has the molecular formula C17H14FN3S
and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine.
Molecular Properties
| Compound Name | 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine |
| PubChem CID | 135153190 |
| Molecular Formula | C17H14FN3S |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine |
| SMILES | CC1(C)Cc2c(F)cccc2C(c2cc3sccc3nn2)=N1 |
| InChI | InChI=1S/C17H14FN3S/c1-17(2)9-11-10(4-3-5-12(11)18)16(19-17)14-8-15-13(20-21-14)6-7-22-15/h3-8H,9H2,1-2H3 |
| InChIKey | OHPJFHTUDJOLHP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine?
The IUPAC name of 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine (CID 135153190) is 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine.
What is the SMILES notation for 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine?
The canonical SMILES for 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine is CC1(C)Cc2c(F)cccc2C(c2cc3sccc3nn2)=N1.
What is the InChIKey of 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine?
The InChIKey is OHPJFHTUDJOLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3S/c1-17(2)9-11-10(4-3-5-12(11)18)16(19-17)14-8-15-13(20-21-14)6-7-22-15/h3-8H,9H2,1-2H3.
What are the key properties of 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine?
3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine has a molecular weight of 311.39 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)thieno[3,2-c]pyridazine is sourced from PubChem (CID 135153190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).