C18H19BrFN3O4 — CID 135154375
methyl 5-bromo-2-fluoro-6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 135154375) has the molecular formula C18H19BrFN3O4 and a molecular weight of 440.27 g/mol. Its IUPAC name is methyl 5-bromo-2-fluoro-6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-2-fluoro-6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 135154375 |
| Molecular Formula | C18H19BrFN3O4 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | methyl 5-bromo-2-fluoro-6-[4-[(6-methoxy-3-pyridinyl)oxy]piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Br)c(N2CCC(Oc3ccc(OC)nc3)CC2)nc1F |
| InChI | InChI=1S/C18H19BrFN3O4/c1-25-15-4-3-12(10-21-15)27-11-5-7-23(8-6-11)17-14(19)9-13(16(20)22-17)18(24)26-2/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | BVEXKZYHQWPJRU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|