C16H15BrFNO2 — CID 135155645
(7S)-4-bromo-3-fluoro-7-prop-1-en-2-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid (PubChem CID 135155645) has the molecular formula C16H15BrFNO2 and a molecular weight of 352.20 g/mol. Its IUPAC name is (7S)-4-bromo-3-fluoro-7-prop-1-en-2-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid.
| Compound Name | (7S)-4-bromo-3-fluoro-7-prop-1-en-2-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 135155645 |
| Molecular Formula | C16H15BrFNO2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (7S)-4-bromo-3-fluoro-7-prop-1-en-2-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid |
| SMILES | C=C(C)[C@H]1CCc2c([nH]c3c(C(=O)O)cc(F)c(Br)c23)C1 |
| InChI | InChI=1S/C16H15BrFNO2/c1-7(2)8-3-4-9-12(5-8)19-15-10(16(20)21)6-11(18)14(17)13(9)15/h6,8,19H,1,3-5H2,2H3,(H,20,21)/t8-/m0/s1 |
| InChIKey | KBNRSRPCRFDTQW-QMMMGPOBSA-N |
| XLogP | 4.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|