C13H11FN2O4 — CID 135156643
2-(2,6-dioxopiperidin-3-yl)-6-fluoro-3,7a-dihydroisoindole-1,7-dione (PubChem CID 135156643) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-3,7a-dihydroisoindole-1,7-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-3,7a-dihydroisoindole-1,7-dione |
|---|---|
| PubChem CID | 135156643 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-3,7a-dihydroisoindole-1,7-dione |
| SMILES | O=C1CCC(N2CC3=CC=C(F)C(=O)C3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H11FN2O4/c14-7-2-1-6-5-16(13(20)10(6)11(7)18)8-3-4-9(17)15-12(8)19/h1-2,8,10H,3-5H2,(H,15,17,19) |
| InChIKey | QIDNPUNRNHVEFN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|