C19H23N3O3 — CID 135156651
tert-butyl N-[(3R)-3-phenyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-7-yl]carbamate (PubChem CID 135156651) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-phenyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-7-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-phenyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-7-yl]carbamate |
|---|---|
| PubChem CID | 135156651 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | tert-butyl N-[(3R)-3-phenyl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc2c(c1)CN[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C19H23N3O3/c1-19(2,3)25-18(23)22-15-9-14-10-20-16(12-24-17(14)21-11-15)13-7-5-4-6-8-13/h4-9,11,16,20H,10,12H2,1-3H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | VCCALFKUYQOBPR-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |