About 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine
6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine (PubChem CID 135156975) has the molecular formula C14H20ClN3O3
and a molecular weight of 313.79 g/mol. Its IUPAC name is 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine |
| PubChem CID | 135156975 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine |
| SMILES | COC(COCc1nc2cnc(Cl)cc2n1C(C)C)OC |
| InChI | InChI=1S/C14H20ClN3O3/c1-9(2)18-11-5-12(15)16-6-10(11)17-13(18)7-21-8-14(19-3)20-4/h5-6,9,14H,7-8H2,1-4H3 |
| InChIKey | QVHKXIAXQUAZDT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine?
The IUPAC name of 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine (CID 135156975) is 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine.
What is the SMILES notation for 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine?
The canonical SMILES for 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine is COC(COCc1nc2cnc(Cl)cc2n1C(C)C)OC.
What is the InChIKey of 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine?
The InChIKey is QVHKXIAXQUAZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3O3/c1-9(2)18-11-5-12(15)16-6-10(11)17-13(18)7-21-8-14(19-3)20-4/h5-6,9,14H,7-8H2,1-4H3.
What are the key properties of 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine?
6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine has a molecular weight of 313.79 g/mol, XLogP of 2.80, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2,2-dimethoxyethoxymethyl)-1-propan-2-ylimidazo[4,5-c]pyridine is sourced from PubChem (CID 135156975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).